Difference between revisions of "LYS"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-24_001300 == * left end position: ** 1469840 * transcription direction: ** NEGATIVE * right end position: ** 1480728 * centisome position: ** 29.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-24_001300 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
−
* left end position:
+
* smiles:
−
** 1469840
+
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
−
* right end position:
+
* common name:
−
** 1480728
+
** prephytoene diphosphate
−
* centisome position:
+
* molecular weight:
−
** 29.46946    
+
** 719.897    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0019_0171
+
** (1R,2R,3R)-prephytoene diphosphate
−
** Esi0019_0171
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[RXNARA-8002]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[2.5.1.32-RXN]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1469840}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
−
{{#set: right end position=1480728}}
+
* CHEBI:
−
{{#set: centisome position=29.46946   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
−
{{#set: common name=Esi_0019_0171|Esi0019_0171}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
 +
* HMDB : HMDB03023
 +
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
 +
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K}}
 +
{{#set: common name=prephytoene diphosphate}}
 +
{{#set: molecular weight=719.897   }}
 +
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
 +
{{#set: consumed by=RXNARA-8002}}
 +
{{#set: produced by=2.5.1.32-RXN}}

Revision as of 22:05, 17 March 2018

Metabolite CPD-464

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
  • inchi key:
    • InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
  • common name:
    • prephytoene diphosphate
  • molecular weight:
    • 719.897
  • Synonym(s):
    • (1R,2R,3R)-prephytoene diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=LYS&oldid=15715"