Difference between revisions of "Ec-18 000430"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...")
 
(Created page with "Category:Gene == Gene Ec-07_003840 == * left end position: ** 3855714 * transcription direction: ** POSITIVE * right end position: ** 3861512 * centisome position: ** 49.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
+
== Gene Ec-07_003840 ==
−
* smiles:
+
* left end position:
−
** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** 3855714
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (R)-S-lactoylglutathione
+
** 3861512
−
* molecular weight:
+
* centisome position:
−
** 378.376    
+
** 49.92877    
 
* Synonym(s):
 
* Synonym(s):
−
** S-D-lactoylglutathione
+
** Esi_0046_0079
−
** D-lactoylglutathione
+
** Esi0046_0079
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[GLYOXII-RXN]]
+
* [[6.3.2.25-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
−
* [[GLYOXI-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 25138-66-3
+
{{#set: left end position=3855714}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377]
+
{{#set: right end position=3861512}}
−
* HMDB : HMDB01066
+
{{#set: centisome position=49.92877   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0046_0079|Esi0046_0079}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451]
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474]
+
−
* BIGG : 41876
+
−
{{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}}
+
−
{{#set: common name=(R)-S-lactoylglutathione}}
+
−
{{#set: molecular weight=378.376   }}
+
−
{{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}}
+
−
{{#set: consumed by=GLYOXII-RXN}}
+
−
{{#set: consumed or produced by=GLYOXI-RXN}}
+

Revision as of 22:05, 17 March 2018

Gene Ec-07_003840

  • left end position:
    • 3855714
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3861512
  • centisome position:
    • 49.92877
  • Synonym(s):
    • Esi_0046_0079
    • Esi0046_0079

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_000430&oldid=15716"