Difference between revisions of "Ec-00 009240"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...") |
(Created page with "Category:Gene == Gene Ec-13_002360 == * left end position: ** 4062657 * transcription direction: ** POSITIVE * right end position: ** 4065260 * centisome position: ** 58.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_002360 == |
− | * | + | * left end position: |
− | ** | + | ** 4062657 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4065260 |
− | * | + | * centisome position: |
− | ** | + | ** 58.57123 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0386_0004 |
− | ** | + | ** Esi0386_0004 |
+ | ** GST | ||
− | == | + | == Reactions associated == |
− | + | * [[GSHTRAN-RXN]] | |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
+ | * [[GST-RXN]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | * [[RXN-13673]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | * [[RXN-15680]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7112]] | ||
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4062657}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4065260}} | |
− | + | {{#set: centisome position=58.57123 }} | |
− | + | {{#set: common name=Esi_0386_0004|Esi0386_0004|GST}} | |
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:05, 17 March 2018
Gene Ec-13_002360
- left end position:
- 4062657
- transcription direction:
- POSITIVE
- right end position:
- 4065260
- centisome position:
- 58.57123
- Synonym(s):
- Esi_0386_0004
- Esi0386_0004
- GST
Reactions associated
- GSHTRAN-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- GST-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-13673
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-15680
- esiliculosus_genome
- ec-number
- esiliculosus_genome