Difference between revisions of "Ec-19 002580"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-23_002110 == * left end position: ** 2182018 * transcription direction: ** POSITIVE * right end position: ** 2192284 * centisome position: ** 45.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_002110 == |
− | * | + | * left end position: |
− | ** | + | ** 2182018 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2192284 |
− | * | + | * centisome position: |
− | ** | + | ** 45.087982 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0042_0037 |
− | ** | + | ** Esi0042_0037 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[1.5.5.1-RXN]] |
− | + | ** esiliculosus_genome | |
− | + | ***ec-number | |
− | * [[ | + | * [[RXN66-550]] |
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2182018}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2192284}} | |
− | + | {{#set: centisome position=45.087982 }} | |
− | + | {{#set: common name=Esi_0042_0037|Esi0042_0037}} | |
− | + | {{#set: reaction associated=1.5.5.1-RXN|RXN66-550}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 22:05, 17 March 2018
Gene Ec-23_002110
- left end position:
- 2182018
- transcription direction:
- POSITIVE
- right end position:
- 2192284
- centisome position:
- 45.087982
- Synonym(s):
- Esi_0042_0037
- Esi0042_0037
Reactions associated
- 1.5.5.1-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN66-550
- esiliculosus_genome
- ec-number
- esiliculosus_genome