Difference between revisions of "Ec-24 003940"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-02_000300 == * left end position: ** 291900 * transcription direction: ** NEGATIVE * right end position: ** 296320 * centisome position: ** 4.4716...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_000300 == |
− | * | + | * left end position: |
− | ** | + | ** 291900 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 296320 |
− | * | + | * centisome position: |
− | ** | + | ** 4.47165 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0083_0050 | ||
+ | ** Esi0083_0050 | ||
− | == | + | == Reactions associated == |
− | + | * [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=291900}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=296320}} | |
− | + | {{#set: centisome position=4.47165 }} | |
− | + | {{#set: common name=Esi_0083_0050|Esi0083_0050}} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:05, 17 March 2018
Gene Ec-02_000300
- left end position:
- 291900
- transcription direction:
- NEGATIVE
- right end position:
- 296320
- centisome position:
- 4.47165
- Synonym(s):
- Esi_0083_0050
- Esi0083_0050
Reactions associated
- NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome