Difference between revisions of "Ec-02 005010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...")
 
(Created page with "Category:Gene == Gene Ec-27_004000 == * left end position: ** 3492111 * transcription direction: ** NEGATIVE * right end position: ** 3494381 * centisome position: ** 54.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] ==
+
== Gene Ec-27_004000 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
+
** 3492111
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
+
** 3494381
−
* molecular weight:
+
* centisome position:
−
** 362.42    
+
** 54.142033    
 
* Synonym(s):
 
* Synonym(s):
−
** ACV
+
** Esi_0000_0454
−
** L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
+
** Esi0000_0454
−
** δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
+
−
** N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.21.3.1-RXN]]
+
* [[2PGADEHYDRAT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[PWY-7124]]
 +
* [[PWY-1622]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[NPGLUCAT-PWY]]
 +
* [[PWY-7218]]
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY-5723]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3492111}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820470 91820470]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3494381}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58572 58572]
+
{{#set: centisome position=54.142033    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0000_0454|Esi0000_0454}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05556 C05556]
+
{{#set: reaction associated=2PGADEHYDRAT-RXN}}
−
{{#set: smiles=CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]}}
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|PWY-7124|PWY-1622|GLUCONEO-PWY|GLYCOLYSIS|NPGLUCAT-PWY|PWY-7218|PWY-6901|P124-PWY|PWY-6886|PWY-5723|ANAGLYCOLYSIS-PWY|P122-PWY|PWY-7003|PWY-6142|PWY-5484|PWY66-399}}
−
{{#set: inchi key=InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M}}
+
−
{{#set: common name=N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
−
{{#set: molecular weight=362.42    }}
+
−
{{#set: common name=ACV|L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine|δ(L-2-aminoadipyl)-L-cysteinyl-D-valine|N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
−
{{#set: consumed by=1.21.3.1-RXN}}
+

Revision as of 23:05, 17 March 2018

Gene Ec-27_004000

  • left end position:
    • 3492111
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3494381
  • centisome position:
    • 54.142033
  • Synonym(s):
    • Esi_0000_0454
    • Esi0000_0454

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_005010&oldid=15764"