Difference between revisions of "Ec-19 001450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * inchi key...")
 
(Created page with "Category:Gene == Gene Ec-14_003790 == * left end position: ** 3537051 * transcription direction: ** NEGATIVE * right end position: ** 3542109 * centisome position: ** 53.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] ==
+
== Gene Ec-14_003790 ==
−
* smiles:
+
* left end position:
−
** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
+
** 3537051
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** hypoglycin B
+
** 3542109
−
* molecular weight:
+
* centisome position:
−
** 269.277    
+
** 53.91494    
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine B
+
** Esi_0286_0006
−
** L-gamma-glutamyl-L-hypoglycin
+
** Esi0286_0006
−
** γ-glutamyl-β-(methylenecyclopropyl)-alanine
+
−
** (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[CDPDIGLYSYN-RXN]]
−
* [[RXN-9157]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[RXN0-5515]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-5667]]
 +
* [[PWY0-1319]]
 +
* [[PWY-5981]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3537051}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135]
+
{{#set: transcription direction=NEGATIVE}}
−
* Wikipedia : Hypoglycin_B
+
{{#set: right end position=3542109}}
−
* LIGAND-CPD:
+
{{#set: centisome position=53.91494   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280]
+
{{#set: common name=Esi_0286_0006|Esi0286_0006}}
−
* HMDB : HMDB29428
+
{{#set: reaction associated=CDPDIGLYSYN-RXN|RXN0-5515}}
−
{{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}}
+
{{#set: pathway associated=PWY-5667|PWY0-1319|PWY-5981}}
−
{{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}}
+
−
{{#set: common name=hypoglycin B}}
+
−
{{#set: molecular weight=269.277   }}
+
−
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}
+
−
{{#set: produced by=RXN-9157}}
+

Revision as of 22:05, 17 March 2018

Gene Ec-14_003790

  • left end position:
    • 3537051
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3542109
  • centisome position:
    • 53.91494
  • Synonym(s):
    • Esi_0286_0006
    • Esi0286_0006

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_001450&oldid=15768"