Difference between revisions of "5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-19_002580 == * left end position: ** 2875570 * transcription direction: ** NEGATIVE * right end position: ** 2878296 * centisome position: ** 48.1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-19_002580 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] ==
−
* left end position:
+
* smiles:
−
** 2875570
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
−
* right end position:
+
* common name:
−
** 2878296
+
** 3-oxoadipyl-CoA
−
* centisome position:
+
* molecular weight:
−
** 48.16145    
+
** 904.605    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0035_0093
+
** 3-ketoadipyl-CoA
−
** Esi0035_0093
+
** 3-keto-adipyl-coa
 +
** β-ketoadipyl-CoA
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GLYOXIII-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
−
***automated-name-match
+
* [[RXN0-2044]]
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2875570}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578]
−
{{#set: right end position=2878296}}
+
* CHEBI:
−
{{#set: centisome position=48.16145   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57348 57348]
−
{{#set: common name=Esi_0035_0093|Esi0035_0093}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=GLYOXIII-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232]
 +
* HMDB : HMDB60378
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I}}
 +
{{#set: common name=3-oxoadipyl-CoA}}
 +
{{#set: molecular weight=904.605   }}
 +
{{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}}
 +
{{#set: reversible reaction associated=RXN0-2044}}

Revision as of 22:06, 17 March 2018

Metabolite 3-KETO-ADIPYL-COA

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
  • common name:
    • 3-oxoadipyl-CoA
  • molecular weight:
    • 904.605
  • Synonym(s):
    • 3-ketoadipyl-CoA
    • 3-keto-adipyl-coa
    • β-ketoadipyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE&oldid=15769"