Difference between revisions of "Ec-10 002590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] == * smiles: ** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Gene == Gene Ec-24_002300 == * left end position: ** 2624689 * transcription direction: ** POSITIVE * right end position: ** 2633478 * centisome position: ** 52.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] ==
+
== Gene Ec-24_002300 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 2624689
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** sapienoyl-CoA
+
** 2633478
−
* molecular weight:
+
* centisome position:
−
** 999.899    
+
** 52.623528    
 
* Synonym(s):
 
* Synonym(s):
−
** Δ6-hexadecenoyl-CoA
+
** Esi_0060_0101
−
** (6Z)-hexadec-6-enoyl-CoA
+
** Esi0060_0101
−
** (6Z)-hexadecenoyl-CoA
+
−
** 16:1, n-10, cis-6 hexadecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[1.14.19.3-RXN]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-13426]]
 +
** esiliculosus_genome
 +
***ec-number
 
* [[RXN-16065]]
 
* [[RXN-16065]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-16132]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-17112]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7049]]
 +
* [[PWY-7726]]
 +
* [[PWY-7606]]
 +
* [[PWY-6000]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2624689}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627261 71627261]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2633478}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74339 74339]
+
{{#set: centisome position=52.623528   }}
−
{{#set: smiles=CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0060_0101|Esi0060_0101}}
−
{{#set: inchi key=InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J}}
+
{{#set: reaction associated=1.14.19.3-RXN|RXN-13426|RXN-16065|RXN-16132|RXN-17112}}
−
{{#set: common name=sapienoyl-CoA}}
+
{{#set: pathway associated=PWY-7049|PWY-7726|PWY-7606|PWY-6000}}
−
{{#set: molecular weight=999.899   }}
+
−
{{#set: common name=Δ6-hexadecenoyl-CoA|(6Z)-hexadec-6-enoyl-CoA|(6Z)-hexadecenoyl-CoA|16:1, n-10, cis-6 hexadecenoyl-CoA}}
+
−
{{#set: produced by=RXN-16065}}
+

Revision as of 22:06, 17 March 2018

Gene Ec-24_002300

  • left end position:
    • 2624689
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2633478
  • centisome position:
    • 52.623528
  • Synonym(s):
    • Esi_0060_0101
    • Esi0060_0101

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_002590&oldid=15770"