Difference between revisions of "CPD-5170"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-24_003940 == * left end position: ** 4319512 * transcription direction: ** POSITIVE * right end position: ** 4336969 * centisome position: ** 86.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-24-ethyl-cholest-5-ene |
| − | * | + | * molecular weight: |
| − | ** | + | ** 412.698 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-12789]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811] | |
| − | {{#set: | + | {{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=3-oxo-24-ethyl-cholest-5-ene}} |
| − | {{#set: | + | {{#set: molecular weight=412.698 }} |
| − | {{#set: | + | {{#set: produced by=RXN-12789}} |
Revision as of 22:06, 17 March 2018
Contents
Metabolite CPD-13793
- smiles:
- CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
- common name:
- 3-oxo-24-ethyl-cholest-5-ene
- molecular weight:
- 412.698
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
