Difference between revisions of "2-ACETO-LACTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4441 CPD-4441] == * smiles: ** CC(CO)=CCNC2(C1(=C(NC=N1)N=CN=2)) * inchi key: ** InChIKey=U...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-HECT-E3-UCP-L-cysteine S-ubiquitinyl-HECT-E3-UCP-L-cysteine] == * common name: **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ubiquitinyl-HECT-E3-UCP-L-cysteine S-ubiquitinyl-HECT-E3-UCP-L-cysteine] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15560]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15559]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine}} | |
| − | + | {{#set: consumed by=RXN-15560}} | |
| − | + | {{#set: produced by=RXN-15559}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 22:06, 17 March 2018
Contents
Metabolite S-ubiquitinyl-HECT-E3-UCP-L-cysteine
- common name:
- an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine" cannot be used as a page name in this wiki.
