Difference between revisions of "3-HYDROXY-DOCOSAPENTAENOYL-ACP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J |
* common name: | * common name: | ||
− | ** | + | ** dITP |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 488.137 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** deoxyinosine triphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-1602]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14228]] | ||
== External links == | == External links == | ||
+ | * BIGG : 37399 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203822 25203822] |
+ | * HMDB : HMDB03537 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01345 C01345] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61382 61382] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC61382 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J}} |
− | {{#set: molecular weight= | + | {{#set: common name=dITP}} |
− | {{#set: common name= | + | {{#set: molecular weight=488.137 }} |
− | {{#set: consumed by= | + | {{#set: common name=deoxyinosine triphosphate}} |
− | {{#set: | + | {{#set: consumed by=RXN0-1602}} |
+ | {{#set: reversible reaction associated=RXN-14228}} |
Revision as of 22:07, 17 March 2018
Contents
Metabolite DITP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- inchi key:
- InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J
- common name:
- dITP
- molecular weight:
- 488.137
- Synonym(s):
- deoxyinosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 37399
- PUBCHEM:
- HMDB : HMDB03537
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61382
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.