Difference between revisions of "PWY4FS-4"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2582 PWY-2582] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2582 PWY-2582] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** brassinosteroid biosynthesis II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''21''' reactions in the full pathway |
− | * [[ | + | * [[RXN-4225]] |
− | * [[RXN- | + | ** 3 associated gene(s): |
− | * [[RXN- | + | *** [[Ec-10_006240]] |
− | * [[ | + | *** [[Ec-00_005850]] |
− | == Reaction(s) | + | *** [[Ec-00_005820]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | == | + | *** [[orthology-aragem]] |
− | * [[ | + | * [[RXN-4231]] |
− | * [[ | + | ** 3 associated gene(s): |
+ | *** [[Ec-00_005850]] | ||
+ | *** [[Ec-10_006240]] | ||
+ | *** [[Ec-00_005820]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-711]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-17_002880]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-773]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-10_006240]] | ||
+ | *** [[Ec-00_005850]] | ||
+ | *** [[Ec-00_005820]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11101 RXN-11101] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11529 RXN-11529] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11530 RXN-11530] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11531 RXN-11531] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11532 RXN-11532] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11533 RXN-11533] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11534 RXN-11534] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4226 RXN-4226] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4228 RXN-4228] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4229 RXN-4229] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4230 RXN-4230] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-709 RXN-709] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-710 RXN-710] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-712 RXN-712] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-774 RXN-774] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-775 RXN-775] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-776 RXN-776] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-2582 PWY-2582] | |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | ** [http:// | + | {{#set: common name=brassinosteroid biosynthesis II}} |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=21}} | |
− | + | {{#set: completion rate=19.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 13:10, 21 March 2018
Pathway PWY-2582
- taxonomic range:
- common name:
- brassinosteroid biosynthesis II
- Synonym(s):
Reaction(s) found
4 reactions found over 21 reactions in the full pathway
- RXN-4225
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-4231
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-711
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-773
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- RXN-11101
- RXN-11529
- RXN-11530
- RXN-11531
- RXN-11532
- RXN-11533
- RXN-11534
- RXN-4226
- RXN-4228
- RXN-4229
- RXN-4230
- RXN-709
- RXN-710
- RXN-712
- RXN-774
- RXN-775
- RXN-776
External links
- ARACYC: