Difference between revisions of "Ec-01 006640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234] ==
−
* smiles:
+
* taxonomic range:
−
** CC1(OC(C(C(C1O)O)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
+
 
* common name:
 
* common name:
−
** β-L-fucopyranose
+
** inosine-5'-phosphate biosynthesis III
−
* molecular weight:
+
−
** 164.158   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-L-fucose
+
** IMP biosynthesis I
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[AICARSYN-RXN]]
−
* [[RXN0-5298]]
+
** 1 associated gene(s):
 +
*** [[Ec-11_002070]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_005390]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[SAICARSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10066 RXN-10066]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-742 RXN0-742]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-743 RXN0-743]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03283
+
{{#set: taxonomic range=TAX-2157}}
−
* PUBCHEM:
+
{{#set: common name=inosine-5'-phosphate biosynthesis III}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863]
+
{{#set: common name=IMP biosynthesis I}}
−
* HMDB : HMDB59625
+
{{#set: reaction found=3}}
−
* LIGAND-CPD:
+
{{#set: total reaction=6}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
+
{{#set: completion rate=50.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.392667.html 392667]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589]
+
−
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
+
−
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}}
+
−
{{#set: common name=β-L-fucopyranose}}
+
−
{{#set: molecular weight=164.158    }}
+
−
{{#set: common name=β-L-fucose}}
+
−
{{#set: reversible reaction associated=RXN0-5298}}
+

Revision as of 13:10, 21 March 2018

Pathway PWY-7234

  • taxonomic range:
  • common name:
    • inosine-5'-phosphate biosynthesis III
  • Synonym(s):
    • IMP biosynthesis I

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_006640&oldid=16129"