Difference between revisions of "Ec-09 004230"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-475...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** heme biosynthesis II (anaerobic) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''4''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[HEMN-RXN]] |
− | * [ | + | ** 5 associated gene(s): |
+ | *** [[Ec-19_002210]] | ||
+ | *** [[Ec-20_000950]] | ||
+ | *** [[Ec-26_001240]] | ||
+ | *** [[Ec-14_004300]] | ||
+ | *** [[Ec-26_002590]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PROTOHEMEFERROCHELAT-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_005360]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[UROGENDECARBOX-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-24_000620]] | ||
+ | *** [[Ec-01_000360]] | ||
+ | *** [[Ec-24_000650]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6259 RXN0-6259] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-33630}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | {{#set: | + | {{#set: common name=heme biosynthesis II (anaerobic)}} |
− | {{#set: | + | {{#set: reaction found=3}} |
− | {{#set: common name= | + | {{#set: total reaction=4}} |
− | {{#set: | + | {{#set: completion rate=75.0}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:10, 21 March 2018
Pathway HEMESYN2-PWY
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- HEMN-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- PROTOHEMEFERROCHELAT-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- UROGENDECARBOX-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: