Difference between revisions of "Ec-09 004230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-475...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630]
−
** InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** 4-methylphenyl sulfate
+
** heme biosynthesis II (anaerobic)
−
* molecular weight:
+
−
** 187.19   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-cresol sulfate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[HEMN-RXN]]
−
* [[RXN-15588]]
+
** 5 associated gene(s):
 +
*** [[Ec-19_002210]]
 +
*** [[Ec-20_000950]]
 +
*** [[Ec-26_001240]]
 +
*** [[Ec-14_004300]]
 +
*** [[Ec-26_002590]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PROTOHEMEFERROCHELAT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_005360]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[UROGENDECARBOX-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_000620]]
 +
*** [[Ec-01_000360]]
 +
*** [[Ec-24_000650]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6259 RXN0-6259]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4615422 4615422]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://www.chemspider.com/Chemical-Structure.3806481.html 3806481]
+
{{#set: taxonomic range=TAX-33630}}
−
* HMDB : HMDB11635
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: smiles=CC1(C=CC(=CC=1)OS(=O)(=O)[O-])}}
+
{{#set: common name=heme biosynthesis II (anaerobic)}}
−
{{#set: inchi key=InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M}}
+
{{#set: reaction found=3}}
−
{{#set: common name=4-methylphenyl sulfate}}
+
{{#set: total reaction=4}}
−
{{#set: molecular weight=187.19    }}
+
{{#set: completion rate=75.0}}
−
{{#set: common name=p-cresol sulfate}}
+
−
{{#set: reversible reaction associated=RXN-15588}}
+

Revision as of 13:10, 21 March 2018

Pathway HEMESYN2-PWY

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_004230&oldid=16144"