Difference between revisions of "PANTETHEINE-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** 4 | + | ** 4-methylphenyl sulfate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 187.19 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** p-cresol sulfate |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-15588]] |
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4615422 4615422] |
| − | * | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.3806481.html 3806481] | |
| − | ** [http://www. | + | * HMDB : HMDB11635 |
| − | + | {{#set: smiles=CC1(C=CC(=CC=1)OS(=O)(=O)[O-])}} | |
| − | + | {{#set: inchi key=InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M}} | |
| − | * | + | {{#set: common name=4-methylphenyl sulfate}} |
| − | {{#set: smiles= | + | {{#set: molecular weight=187.19 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=p-cresol sulfate}} |
| − | {{#set: common name=4 | + | {{#set: reversible reaction associated=RXN-15588}} |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: reversible reaction associated=RXN- | + | |
Revision as of 13:10, 21 March 2018
Contents
Metabolite CPD-16819
- smiles:
- CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
- inchi key:
- InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
- common name:
- 4-methylphenyl sulfate
- molecular weight:
- 187.19
- Synonym(s):
- p-cresol sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C=CC(=CC=1)OS(=O)(=O)[O-])" cannot be used as a page name in this wiki.
