Difference between revisions of "Ec-07 007070"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_002520 == * left end position: ** 2527747 * transcription direction: ** NEGATIVE * right end position: ** 2561249 * centisome position: ** 49.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (S)-3-hydroxydecanoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 933.753 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-12490]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13616]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616] |
| − | {{#set: | + | * BIGG : 45455 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629] |
| + | * HMDB : HMDB03938 | ||
| + | {{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} | ||
| + | {{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}} | ||
| + | {{#set: common name=(S)-3-hydroxydecanoyl-CoA}} | ||
| + | {{#set: molecular weight=933.753 }} | ||
| + | {{#set: consumed by=RXN-12490}} | ||
| + | {{#set: produced by=RXN-13616}} | ||
Revision as of 13:11, 21 March 2018
Contents
Metabolite CPD0-2244
- smiles:
- CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- inchi key:
- InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
- common name:
- (S)-3-hydroxydecanoyl-CoA
- molecular weight:
- 933.753
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.
