Difference between revisions of "PWY-5461"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CSCCC(C([O-])=CO)=O
 +
* inchi key:
 +
** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
 
* common name:
 
* common name:
−
** C4 photosynthetic carbon assimilation cycle, NAD-ME type
+
** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
 +
* molecular weight:
 +
** 161.195   
 
* Synonym(s):
 
* Synonym(s):
−
** C4 photosynthesis, NAD-ME type
+
** 1,2-dihydroxy-3-keto-5-methylthiopentene anion
 +
** 1,2-dihydroxy-3-keto-5-methylthiopentane
 +
** 1,2-dihydroxy-3-keto-5-methylthiopentene
 +
** acireductone
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''9''' reactions found over '''9''' reactions in the full pathway
+
* [[R147-RXN]]
−
* [[1.1.1.39-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 3 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-01_003680]]
+
−
*** [[Ec-07_002070]]
+
−
*** [[Ec-07_002060]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[ALANINE-AMINOTRANSFERASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_011040]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[ASPAMINOTRANS-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-23_003500]]
+
−
*** [[Ec-03_003270]]
+
−
*** [[Ec-01_007480]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[MALATE-DEH-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-10_006200]]
+
−
*** [[Ec-02_003100]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PEPCARBOX-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-28_003470]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-18_001310]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-13697]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-23_003500]]
+
−
*** [[Ec-01_007480]]
+
−
*** [[Ec-03_003270]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-13698]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_011040]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN0-5224]]
+
−
** 8 associated gene(s):
+
−
*** [[Ec-05_001290]]
+
−
*** [[Ec-10_002770]]
+
−
*** [[Ec-27_005680]]
+
−
*** [[Ec-07_004610]]
+
−
*** [[Ec-16_004700]]
+
−
*** [[Ec-22_001150]]
+
−
*** [[Ec-06_004120]]
+
−
*** [[Ec-03_001960]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33090}}
+
* PUBCHEM:
−
{{#set: common name=C4 photosynthetic carbon assimilation cycle, NAD-ME type}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177]
−
{{#set: common name=C4 photosynthesis, NAD-ME type}}
+
* CHEBI:
−
{{#set: reaction found=9}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795]
−
{{#set: total reaction=9}}
+
* LIGAND-CPD:
−
{{#set: completion rate=100.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606]
 +
* HMDB : HMDB12134
 +
{{#set: smiles=CSCCC(C([O-])=CO)=O}}
 +
{{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}}
 +
{{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}}
 +
{{#set: molecular weight=161.195    }}
 +
{{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}}
 +
{{#set: consumed by=R147-RXN}}

Revision as of 13:11, 21 March 2018

Metabolite CPD-85

  • smiles:
    • CSCCC(C([O-])=CO)=O
  • inchi key:
    • InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
  • common name:
    • 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
  • molecular weight:
    • 161.195
  • Synonym(s):
    • 1,2-dihydroxy-3-keto-5-methylthiopentene anion
    • 1,2-dihydroxy-3-keto-5-methylthiopentane
    • 1,2-dihydroxy-3-keto-5-methylthiopentene
    • acireductone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCC(C([O-])=CO)=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5461&oldid=16276"