Difference between revisions of "Ec-01 004320"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10656 RXN-10656] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10656 RXN-10656] ==
−
* smiles:
+
* direction:
−
** C(CC[N+]CCCCC[N+])[N+]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
−
* common name:
+
−
** aminopropylcadaverine
+
−
* molecular weight:
+
−
** 162.298   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-3-aminopropyl-1,5-diaminopentane
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN0-5217]]
+
** 1 [[3-hydroxy-cis-D7-tetraecenoyl-ACPs]][c] '''=>''' 1 [[Trans-D3-cis-D7-tetradecenoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (3R)-3-hydroxy cis Δ7-tetradecenoyl-[acp][c] '''=>''' 1 a trans-Δ3-cis-Δ7-tetradecenoyl-[acp][c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
{{#set: ec number=EC-4.2.1.59}}
−
* CHEBI:
+
{{#set: in pathway=PWY-6282}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: reconstruction category=gap-filling}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: reconstruction tool=meneco}}
−
* HMDB : HMDB12189
+
{{#set: reconstruction comment=added for gapfilling}}
−
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
−
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
−
{{#set: common name=aminopropylcadaverine}}
+
−
{{#set: molecular weight=162.298    }}
+
−
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
−
{{#set: produced by=RXN0-5217}}
+

Revision as of 13:11, 21 March 2018

Reaction RXN-10656

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6282, palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): PWY-6282
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_004320&oldid=16311"