Difference between revisions of "PWY-6282"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HYVSZV...") |
(Created page with "Category:Gene == Gene Ec-10_000390 == * left end position: ** 463934 * transcription direction: ** NEGATIVE * right end position: ** 469611 * centisome position: ** 7.1363...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_000390 == |
− | * | + | * left end position: |
− | ** | + | ** 463934 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 469611 |
− | * | + | * centisome position: |
− | ** | + | ** 7.136365 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0127_0077 |
− | ** | + | ** Esi0127_0077 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY66-301]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=463934}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=469611}} | |
− | + | {{#set: centisome position=7.136365 }} | |
− | + | {{#set: common name=Esi_0127_0077|Esi0127_0077}} | |
− | + | {{#set: reaction associated=DOPAMINE-BETA-MONOOXYGENASE-RXN}} | |
− | + | {{#set: pathway associated=PWY66-301}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:11, 21 March 2018
Gene Ec-10_000390
- left end position:
- 463934
- transcription direction:
- NEGATIVE
- right end position:
- 469611
- centisome position:
- 7.136365
- Synonym(s):
- Esi_0127_0077
- Esi0127_0077
Reactions associated
- Reaction: DOPAMINE-BETA-MONOOXYGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome