Difference between revisions of "RXN-7163"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=R...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5808 PWY-5808] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-55962 TAX-5...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5808 PWY-5808] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-55962 TAX-55962] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** hyperforin and adhyperforin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''6''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-7813]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-07_006170]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.156-RXN 2.3.1.156-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13549 RXN-13549] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7805 RXN-7805] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7812 RXN-7812] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9135 RXN-9135] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-55962}} | |
| − | + | {{#set: common name=hyperforin and adhyperforin biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=17.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:11, 21 March 2018
Pathway PWY-5808
- taxonomic range:
- common name:
- hyperforin and adhyperforin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- RXN-7813
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
