Difference between revisions of "TRPSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == * common name: ** a dodecanoyl-[acp] * Synonym(s): ** a dod...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] ==
−
* smiles:
+
−
** C(C1(OC(C(C(C=1)O)O)O))([O-])=O
+
−
* inchi key:
+
−
** InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M
+
 
* common name:
 
* common name:
−
** 4-deoxy-L-threo-hex-4-enopyranuronate
+
** a dodecanoyl-[acp]
−
* molecular weight:
+
−
** 175.118   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
+
** a dodecanoyl-[acyl-carrier protein]
−
** 4-deoxy-L-threo-5-hexosulose-uronic acid
+
** a lauryl-[acp]
−
** 4-deoxy-L-threo-5-hexosulose-uronate
+
−
** 4-deoxy-L-threo-hex-4-enopyranuronate
+
−
** 4-deoxy-β-L-threo-hex-4-enopyranuronose
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9535]]
 +
* [[RXN-9653]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12178]]
+
* [[RXN-9661]]
−
* [[RXN-12270]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-16475]]
 
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a dodecanoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819971 91819971]
+
{{#set: common name=a dodecanoyl-[acyl-carrier protein]|a lauryl-[acp]}}
−
* CHEBI:
+
{{#set: consumed by=RXN-9535|RXN-9653}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62482 62482]
+
{{#set: produced by=RXN-9661}}
−
{{#set: smiles=C(C1(OC(C(C(C=1)O)O)O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M}}
+
−
{{#set: common name=4-deoxy-L-threo-hex-4-enopyranuronate}}
+
−
{{#set: molecular weight=175.118    }}
+
−
{{#set: common name=(3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid|4-deoxy-L-threo-5-hexosulose-uronic acid|4-deoxy-L-threo-5-hexosulose-uronate|4-deoxy-L-threo-hex-4-enopyranuronate|4-deoxy-β-L-threo-hex-4-enopyranuronose}}
+
−
{{#set: produced by=RXN-12178|RXN-12270}}
+
−
{{#set: reversible reaction associated=RXN-16475}}
+

Revision as of 13:12, 21 March 2018

Metabolite Dodecanoyl-ACPs

  • common name:
    • a dodecanoyl-[acp]
  • Synonym(s):
    • a dodecanoyl-[acyl-carrier protein]
    • a lauryl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a dodecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a dodecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a lauryl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TRPSYN-PWY&oldid=16493"