Difference between revisions of "Ec-00 006960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] == * direction: ** REVERSIBLE * common name: ** Pyruvate kinase, barrel ** Pyr...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] ==
−
* smiles:
+
* direction:
−
** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
+
 
* common name:
 
* common name:
−
** β-L-fucose 1-phosphate
+
** Pyruvate kinase, barrel
−
* molecular weight:
+
** Pyruvate kinase, alpha/beta
−
** 242.122   
+
** pyruvate kinase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.1.40 EC-2.7.1.40]
 
* Synonym(s):
 
* Synonym(s):
−
** L-Fucose 1-phosphate
 
−
** 6-deoxy-L-galactose 1-phosphate
 
−
** L-fucopyranose 1-(dihydrogen phosphate)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.7.7.30-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PYRUVATE]][c] '''+''' 1 [[DATP]][c] '''<=>''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DADP]][c]
−
* [[FUCOKINASE-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 pyruvate[c] '''+''' 1 dATP[c] '''<=>''' 1 phosphoenolpyruvate[c] '''+''' 1 H+[c] '''+''' 1 dADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_006860]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_004170]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266535 45266535]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30730 30730]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57268 57268]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01138 R01138]
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02985 C02985]
+
{{#set: common name=Pyruvate kinase, barrel}}
−
* HMDB : HMDB01265
+
{{#set: common name=Pyruvate kinase, alpha/beta}}
−
{{#set: smiles=CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
+
{{#set: common name=pyruvate kinase}}
−
{{#set: inchi key=InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L}}
+
{{#set: ec number=EC-2.7.1.40}}
−
{{#set: common name=&beta;-L-fucose 1-phosphate}}
+
{{#set: gene associated=Ec-12_000950|Ec-06_006860|Ec-26_004170}}
−
{{#set: molecular weight=242.122    }}
+
{{#set: in pathway=}}
−
{{#set: common name=L-Fucose 1-phosphate|6-deoxy-L-galactose 1-phosphate|L-fucopyranose 1-(dihydrogen phosphate)}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: consumed by=2.7.7.30-RXN}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=FUCOKINASE-RXN}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:12, 21 March 2018

Reaction RXN-14192

  • direction:
    • REVERSIBLE
  • common name:
    • Pyruvate kinase, barrel
    • Pyruvate kinase, alpha/beta
    • pyruvate kinase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_006960&oldid=16505"