Difference between revisions of "RXN-15378"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-03_000880 == * left end position: ** 1092099 * transcription direction: ** POSITIVE * right end position: ** 1094949 * centisome position: ** 16.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-03_000880 == |
− | * | + | * left end position: |
− | ** | + | ** 1092099 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1094949 |
− | * | + | * centisome position: |
− | ** | + | ** 16.727764 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0027_0013 |
+ | ** Esi0027_0013 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-8668]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1092099}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1094949}} | |
− | + | {{#set: centisome position=16.727764 }} | |
− | + | {{#set: common name=Esi_0027_0013|Esi0027_0013}} | |
− | + | {{#set: reaction associated=RXN-8668}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:12, 21 March 2018
Gene Ec-03_000880
- left end position:
- 1092099
- transcription direction:
- POSITIVE
- right end position:
- 1094949
- centisome position:
- 16.727764
- Synonym(s):
- Esi_0027_0013
- Esi0027_0013
Reactions associated
- Reaction: RXN-8668
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome