Difference between revisions of "Ec-00 008830"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5143 PWY-5143] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5143 PWY-5143] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CC([CH]=O)C(=O)[O-]
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
 
* common name:
 
* common name:
−
** long-chain fatty acid activation
+
** (R)-methylmalonate-semialdehyde
 +
* molecular weight:
 +
** 101.082   
 
* Synonym(s):
 
* Synonym(s):
−
** long-chain acyl-CoA synthetase pathway
+
** (R)-2-methyl-3-oxopropanoate
 +
** (R)-ch3-malonate-semialdehyde
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-7904]]
+
== Reaction(s) of unknown directionality ==
−
** 4 associated gene(s):
+
* [[RXN-14056]]
−
*** [[Ec-01_001560]]
+
−
*** [[Ec-02_006430]]
+
−
*** [[Ec-12_008720]]
+
−
*** [[Ec-03_003710]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5143 PWY-5143]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
−
{{#set: taxonomic range=TAX-2157}}
+
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
−
{{#set: taxonomic range=TAX-2759}}
+
{{#set: common name=(R)-methylmalonate-semialdehyde}}
−
{{#set: common name=long-chain fatty acid activation}}
+
{{#set: molecular weight=101.082    }}
−
{{#set: common name=long-chain acyl-CoA synthetase pathway}}
+
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
−
{{#set: reaction found=1}}
+
{{#set: reversible reaction associated=RXN-14056}}
−
{{#set: total reaction=1}}
+
−
{{#set: completion rate=100.0}}
+

Revision as of 13:12, 21 March 2018

Metabolite CPD-12177

  • smiles:
    • CC([CH]=O)C(=O)[O-]
  • inchi key:
    • InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
  • common name:
    • (R)-methylmalonate-semialdehyde
  • molecular weight:
    • 101.082
  • Synonym(s):
    • (R)-2-methyl-3-oxopropanoate
    • (R)-ch3-malonate-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_008830&oldid=16565"