Difference between revisions of "LIPASYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18489 CPD-18489] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == * smiles: ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N |
* common name: | * common name: | ||
− | ** | + | ** torulene |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 534.867 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3',4'-didehydro-β,ψ-carotene |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11989]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10218186 10218186] |
− | {{#set: common name= | + | * CHEMSPIDER: |
− | {{#set: molecular weight= | + | ** [http://www.chemspider.com/Chemical-Structure.8393678.html 8393678] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: consumed by=RXN- | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9638 9638] |
− | + | * LIGAND-CPD: | |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08613 C08613] | ||
+ | {{#set: smiles=CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N}} | ||
+ | {{#set: common name=torulene}} | ||
+ | {{#set: molecular weight=534.867 }} | ||
+ | {{#set: common name=3',4'-didehydro-β,ψ-carotene}} | ||
+ | {{#set: consumed by=RXN-11989}} |
Revision as of 14:12, 21 March 2018
Contents
Metabolite CPD-7953
- smiles:
- CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C
- inchi key:
- InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N
- common name:
- torulene
- molecular weight:
- 534.867
- Synonym(s):
- 3',4'-didehydro-β,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links