Difference between revisions of "PWY-5532"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LIPASYN-PWY LIPASYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L |
* common name: | * common name: | ||
| − | ** | + | ** gibberellin A15 (open lactone form) |
| + | * molecular weight: | ||
| + | ** 346.422 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** gibberellin A15 |
| + | ** GA15 | ||
| + | ** GA15 (open lactone form) | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN1F-163]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN1F-162]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMPR0104170017 |
| − | ** [http:// | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860] |
| − | {{#set: | + | {{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}} |
| − | {{#set: | + | {{#set: common name=gibberellin A15 (open lactone form)}} |
| + | {{#set: molecular weight=346.422 }} | ||
| + | {{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}} | ||
| + | {{#set: consumed by=RXN1F-163}} | ||
| + | {{#set: produced by=RXN1F-162}} | ||
Revision as of 13:12, 21 March 2018
Contents
Metabolite CPD1F-97
- smiles:
- C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
- common name:
- gibberellin A15 (open lactone form)
- molecular weight:
- 346.422
- Synonym(s):
- gibberellin A15
- GA15
- GA15 (open lactone form)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.
