Difference between revisions of "PWY-5022"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGINE-BIOSYNTHESIS ASPARAGINE-BIOSYNTHESIS] == * taxonomic range: ** [http://metacyc.org/META/NE...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGINE-BIOSYNTHESIS ASPARAGINE-BIOSYNTHESIS] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** L-asparagine biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
− | * [[ | + | * [[ASNSYNB-RXN]] |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[Ec-28_000990]] | ||
+ | *** [[Ec-15_004750]] | ||
+ | *** [[Ec-15_003670]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ASPARAGINE-BIOSYNTHESIS ASPARAGINE-BIOSYNTHESIS] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=L-asparagine biosynthesis I}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=1}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:12, 21 March 2018
Contents
Pathway ASPARAGINE-BIOSYNTHESIS
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- ASNSYNB-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: