Difference between revisions of "RXN-17736"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-10_003470 == * left end position: ** 3514088 * transcription direction: ** NEGATIVE * right end position: ** 3519989 * centisome position: ** 54.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-10_003470 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
−
* left end position:
+
* smiles:
−
** 3514088
+
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
−
* right end position:
+
* common name:
−
** 3519989
+
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
−
* centisome position:
+
* molecular weight:
−
** 54.054703    
+
** 354.213    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0117_0044
+
** 5-amino-6-(5'-phosphoribitylamino)uracil
−
** Esi0117_0044
+
** 5-amino-6-(5-phosphoribitylamino)uracil
 +
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RIBOFLAVINSYNREDUC-RXN]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3514088}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
−
{{#set: right end position=3519989}}
+
* CHEBI:
−
{{#set: centisome position=54.054703   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
−
{{#set: common name=Esi_0117_0044|Esi0117_0044}}
+
* BIGG : 43851
−
{{#set: reaction associated=GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
 +
* HMDB : HMDB03841
 +
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
 +
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
 +
{{#set: molecular weight=354.213   }}
 +
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
 +
{{#set: produced by=RIBOFLAVINSYNREDUC-RXN}}

Revision as of 14:12, 21 March 2018

Metabolite CPD-1086

  • smiles:
    • C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
  • inchi key:
    • InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
  • common name:
    • 5-amino-6-(5-phospho-D-ribitylamino)uracil
  • molecular weight:
    • 354.213
  • Synonym(s):
    • 5-amino-6-(5'-phosphoribitylamino)uracil
    • 5-amino-6-(5-phosphoribitylamino)uracil
    • 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17736&oldid=16640"