Difference between revisions of "PWY-7102"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-28_002290 == * left end position: ** 2087744 * transcription direction: ** POSITIVE * right end position: ** 2102768 * centisome position: ** 55.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_002290 == |
− | * | + | * left end position: |
− | ** | + | ** 2087744 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2102768 |
− | * | + | * centisome position: |
− | ** | + | ** 55.09984 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0033_0113 |
− | ** | + | ** Esi0033_0113 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2.7.10.1-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2087744}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=2102768}} |
− | {{#set: | + | {{#set: centisome position=55.09984 }} |
− | {{#set: | + | {{#set: common name=Esi_0033_0113|Esi0033_0113}} |
− | {{#set: | + | {{#set: reaction associated=2.7.10.1-RXN|PROTEIN-KINASE-RXN}} |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 14:13, 21 March 2018
Gene Ec-28_002290
- left end position:
- 2087744
- transcription direction:
- POSITIVE
- right end position:
- 2102768
- centisome position:
- 55.09984
- Synonym(s):
- Esi_0033_0113
- Esi0033_0113
Reactions associated
- Reaction: 2.7.10.1-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome