Difference between revisions of "RXN-14213"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Arachidoyl-ACPs Arachidoyl-ACPs] == * common name: ** an arachidoyl-[acp] * Synonym(s): == Rea...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Arachidoyl-ACPs Arachidoyl-ACPs] ==
* smiles:
+
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
+
* inchi key:
+
** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
+
 
* common name:
 
* common name:
** 4-amino-4-deoxychorismate
+
** an arachidoyl-[acp]
* molecular weight:
+
** 224.193   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-445]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-395]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ADCLY-RXN]]
 
* [[PABASYN-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 97279-79-3
+
{{#set: common name=an arachidoyl-[acp]}}
* PUBCHEM:
+
{{#set: consumed by=RXN1G-445}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632]
+
{{#set: produced by=RXN1G-395}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406]
+
* BIGG : 214284
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355]
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}}
+
{{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}}
+
{{#set: common name=4-amino-4-deoxychorismate}}
+
{{#set: molecular weight=224.193    }}
+
{{#set: reversible reaction associated=ADCLY-RXN|PABASYN-RXN}}
+

Revision as of 13:13, 21 March 2018

Metabolite Arachidoyl-ACPs

  • common name:
    • an arachidoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an arachidoyl-[acp" cannot be used as a page name in this wiki.