Difference between revisions of "F16BDEPHOS-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OH2OXOGLUTARALDOL-RXN 4OH2OXOGLUTARALDOL-RXN] == * direction: ** REVERSIBLE * common name: ** KDPG...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OH2OXOGLUTARALDOL-RXN 4OH2OXOGLUTARALDOL-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
 +
* inchi key:
 +
** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
 
* common name:
 
* common name:
** KDPG/KHG aldolase
+
** ent-7α-hydroxykaur-16-en-19-oate
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/4.1.3.16 EC-4.1.3.16]
+
** 317.447   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-7-α-hydroxykaurenoate
 +
** ent-7-α-hydroxykaurenoic acid
 +
** 7-hydroxy-kaurenoic acid
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN1F-160]]
** 1 [[CPD-15015]][c] '''<=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[GLYOX]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[1.14.13.79-RXN]]
** 1 4-hydroxy-2-oxoglutarate[c] '''<=>''' 1 pyruvate[c] '''+''' 1 glyoxylate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-27_004070]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[HYDROXYPRODEG-PWY]], trans-4-hydroxy-L-proline degradation I: [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPRODEG-PWY HYDROXYPRODEG-PWY]
+
** '''1''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* LIPID_MAPS : LMPR0104540005
** [http://www.genome.jp/dbget-bin/www_bget?R00470 R00470]
+
* PUBCHEM:
* UNIPROT:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352]
** [http://www.uniprot.org/uniprot/P44480 P44480]
+
* CHEBI:
** [http://www.uniprot.org/uniprot/P0A955 P0A955]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298]
** [http://www.uniprot.org/uniprot/Q9JR44 Q9JR44]
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/O25729 O25729]
+
** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875]
** [http://www.uniprot.org/uniprot/Q9ZKB4 Q9ZKB4]
+
{{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}}
** [http://www.uniprot.org/uniprot/O83578 O83578]
+
{{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}}
** [http://www.uniprot.org/uniprot/Q9WXS1 Q9WXS1]
+
{{#set: common name=ent-7&alpha;-hydroxykaur-16-en-19-oate}}
** [http://www.uniprot.org/uniprot/P50846 P50846]
+
{{#set: molecular weight=317.447    }}
** [http://www.uniprot.org/uniprot/P38448 P38448]
+
{{#set: common name=ent-7-&alpha;-hydroxykaurenoate|ent-7-&alpha;-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}}
** [http://www.uniprot.org/uniprot/Q55872 Q55872]
+
{{#set: consumed by=RXN1F-160}}
** [http://www.uniprot.org/uniprot/P94802 P94802]
+
{{#set: produced by=1.14.13.79-RXN}}
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=KDPG/KHG aldolase}}
+
{{#set: ec number=EC-4.1.3.16}}
+
{{#set: gene associated=Ec-27_004070}}
+
{{#set: in pathway=HYDROXYPRODEG-PWY}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:13, 21 March 2018

Metabolite CPD1F-136

  • smiles:
    • C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
  • inchi key:
    • InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
  • common name:
    • ent-7α-hydroxykaur-16-en-19-oate
  • molecular weight:
    • 317.447
  • Synonym(s):
    • ent-7-α-hydroxykaurenoate
    • ent-7-α-hydroxykaurenoic acid
    • 7-hydroxy-kaurenoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))" cannot be used as a page name in this wiki.