Difference between revisions of "2K-ADIPATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14160 RXN-14160] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerophosphorylethanolami...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1) |
| + | * inchi key: | ||
| + | ** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-amino-4-deoxychorismate |
| − | * | + | * molecular weight: |
| − | + | ** 224.193 | |
| − | ** | + | |
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[ADCLY-RXN]] | |
| − | + | * [[PABASYN-RXN]] | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | * | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 97279-79-3 |
| − | ** [http://www.ebi.ac.uk/ | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406] | |
| − | + | * BIGG : 214284 | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355] |
| − | {{#set: | + | {{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}} |
| − | {{#set: | + | {{#set: common name=4-amino-4-deoxychorismate}} |
| − | + | {{#set: molecular weight=224.193 }} | |
| + | {{#set: reversible reaction associated=ADCLY-RXN|PABASYN-RXN}} | ||
Revision as of 13:14, 21 March 2018
Contents
Metabolite 4-AMINO-4-DEOXYCHORISMATE
- smiles:
- C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
- inchi key:
- InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
- common name:
- 4-amino-4-deoxychorismate
- molecular weight:
- 224.193
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)" cannot be used as a page name in this wiki.
