Difference between revisions of "Ec-04 004280"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_007560 == * left end position: ** 6738284 * transcription direction: ** NEGATIVE * right end position: ** 6747833 * centisome position: ** 80.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 8-oxo-GTP |
| − | * | + | * molecular weight: |
| − | ** | + | ** 535.151 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 8-oxo-guanosine-triphosphate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11409]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271] |
| − | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=8-oxo-GTP}} |
| − | + | {{#set: molecular weight=535.151 }} | |
| − | {{#set: | + | {{#set: common name=8-oxo-guanosine-triphosphate}} |
| + | {{#set: produced by=RXN-11409}} | ||
Revision as of 13:14, 21 March 2018
Contents
Metabolite CPD-12366
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
- common name:
- 8-oxo-GTP
- molecular weight:
- 535.151
- Synonym(s):
- 8-oxo-guanosine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
