Difference between revisions of "PWY-5338"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-D19-37-MOH-38-Me-C57-1-ACPs cis-D19-37-MOH-38-Me-C57-1-ACPs] == * common name: ** a cis-del...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] == * smiles: ** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] == |
| + | * smiles: | ||
| + | ** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** FMN |
| + | * molecular weight: | ||
| + | ** 453.324 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** flavin mononucleotide | ||
| + | ** riboflavin 5'-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9510]] |
| + | * [[FADSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RIBOFLAVINKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 146-17-8 |
| − | {{#set: consumed by= | + | * Wikipedia : Flavin_mononucleotide |
| + | * BIGG : 33703 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229199 44229199] | ||
| + | * HMDB : HMDB01520 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00061 C00061] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58210 58210] | ||
| + | * METABOLIGHTS : MTBLC58210 | ||
| + | {{#set: smiles=CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))}} | ||
| + | {{#set: inchi key=InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K}} | ||
| + | {{#set: common name=FMN}} | ||
| + | {{#set: molecular weight=453.324 }} | ||
| + | {{#set: common name=flavin mononucleotide|riboflavin 5'-phosphate}} | ||
| + | {{#set: consumed by=RXN-9510|FADSYN-RXN}} | ||
| + | {{#set: produced by=RIBOFLAVINKIN-RXN}} | ||
Revision as of 13:14, 21 March 2018
Contents
Metabolite FMN
- smiles:
- CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))
- inchi key:
- InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K
- common name:
- FMN
- molecular weight:
- 453.324
- Synonym(s):
- flavin mononucleotide
- riboflavin 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 146-17-8
- Wikipedia : Flavin_mononucleotide
- BIGG : 33703
- PUBCHEM:
- HMDB : HMDB01520
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58210
"CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))" cannot be used as a page name in this wiki.
