Difference between revisions of "Ec-01 002370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13722 RXN-13722] == * direction: ** REVERSIBLE * common name: ** Homoaconitate hydratase * ec n...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13722 RXN-13722] ==
* smiles:
+
* direction:
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
+
 
* common name:
 
* common name:
** 3-oxododecanoyl-CoA
+
** Homoaconitate hydratase
* molecular weight:
+
* ec number:
** 959.791   
+
** [http://enzyme.expasy.org/EC/4.2.1.114 EC-4.2.1.114]
 
* Synonym(s):
 
* Synonym(s):
** 3-oxolauroyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[HOMO-CIT]][c] '''<=>''' 1 [[HOMO-I-CIT]][c]
* [[RXN-14274]]
+
* With common name(s):
 +
** 1 (2R)-homocitrate[c] '''<=>''' 1 (1R,2S)-homoisocitrate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-13_001950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* RHEA:
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32304 32304]
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
+
{{#set: common name=Homoaconitate hydratase}}
* BIGG : 45453
+
{{#set: ec number=EC-4.2.1.114}}
* PUBCHEM:
+
{{#set: gene associated=Ec-13_001950}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
+
{{#set: in pathway=}}
* HMDB : HMDB03937
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=3-oxododecanoyl-CoA}}
+
{{#set: molecular weight=959.791    }}
+
{{#set: common name=3-oxolauroyl-CoA}}
+
{{#set: reversible reaction associated=RXN-14274}}
+

Revision as of 13:15, 21 March 2018

Reaction RXN-13722

  • direction:
    • REVERSIBLE
  • common name:
    • Homoaconitate hydratase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (2R)-homocitrate[c] <=> 1 (1R,2S)-homoisocitrate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links