Difference between revisions of "CPD-7087"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * inchi key: ** InChIKey=WBYWAXJHA...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYRIBONUCSYN-RXN GLYRIBONUCSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphoribo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYRIBONUCSYN-RXN GLYRIBONUCSYN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phosphoribosylamine-glycine ligase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.3.4.13 EC-6.3.4.13] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[GLY]][c] '''+''' 1 [[5-P-BETA-D-RIBOSYL-AMINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[5-PHOSPHO-RIBOSYL-GLYCINEAMIDE]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 glycine[c] '''+''' 1 5-phospho-β-D-ribosylamine[c] '''=>''' 1 H+[c] '''+''' 1 N1-(5-phospho-β-D-ribosyl)glycinamide[c] '''+''' 1 ADP[c] '''+''' 1 phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-12_005490]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6121]], 5-aminoimidazole ribonucleotide biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6121 PWY-6121] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6122]], 5-aminoimidazole ribonucleotide biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6277]], superpathway of 5-aminoimidazole ribonucleotide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17453 17453] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04144 R04144] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P07244 P07244] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q58347 Q58347] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12039 P12039] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P21872 P21872] |
− | * | + | ** [http://www.uniprot.org/uniprot/P15640 P15640] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P00967 P00967] |
− | * | + | ** [http://www.uniprot.org/uniprot/P16340 P16340] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P22102 P22102] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JWU6 Q9JWU6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43845 P43845] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PN47 Q9PN47] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q64737 Q64737] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P20772 P20772] |
+ | ** [http://www.uniprot.org/uniprot/P26977 P26977] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59492 Q59492] | ||
+ | ** [http://www.uniprot.org/uniprot/P74232 P74232] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42804 Q42804] | ||
+ | ** [http://www.uniprot.org/uniprot/P52421 P52421] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=phosphoribosylamine-glycine ligase}} | ||
+ | {{#set: ec number=EC-6.3.4.13}} | ||
+ | {{#set: gene associated=Ec-12_005490}} | ||
+ | {{#set: in pathway=PWY-6121|PWY-6122|PWY-6277}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 13:15, 21 March 2018
Contents
Reaction GLYRIBONUCSYN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- phosphoribosylamine-glycine ligase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 GLY[c] + 1 5-P-BETA-D-RIBOSYL-AMINE[c] => 1 PROTON[c] + 1 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE[c] + 1 ADP[c] + 1 Pi[c]
- With common name(s):
- 1 ATP[c] + 1 glycine[c] + 1 5-phospho-β-D-ribosylamine[c] => 1 H+[c] + 1 N1-(5-phospho-β-D-ribosyl)glycinamide[c] + 1 ADP[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_005490
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6121, 5-aminoimidazole ribonucleotide biosynthesis I: PWY-6121
- 3 reactions found over 5 reactions in the full pathway
- PWY-6122, 5-aminoimidazole ribonucleotide biosynthesis II: PWY-6122
- 3 reactions found over 5 reactions in the full pathway
- PWY-6277, superpathway of 5-aminoimidazole ribonucleotide biosynthesis: PWY-6277
- 5 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: