Difference between revisions of "2-AMINOACRYLATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-745 RXN0-745] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-triphosphate r...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-745 RXN0-745] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
 +
* inchi key:
 +
** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
 
* common name:
 
* common name:
−
** ribonucleoside-triphosphate reductase
+
** 9(S)-HPOTE
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.17.4.2 EC-1.17.4.2]
+
** 309.425   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
 +
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[Reduced-flavodoxins]][c] '''=>''' 1 [[Oxidized-flavodoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[DATP]][c]
+
* [[RXN-8497]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 a reduced flavodoxin[c] '''=>''' 1 an oxidized flavodoxin[c] '''+''' 1 H2O[c] '''+''' 1 dATP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-04_006460]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-7220]], adenosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ribonucleoside-triphosphate reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426]
−
{{#set: ec number=EC-1.17.4.2}}
+
* CHEBI:
−
{{#set: gene associated=Ec-04_006460}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962]
−
{{#set: in pathway=PWY-7220}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321]
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}}
 +
{{#set: common name=9(S)-HPOTE}}
 +
{{#set: molecular weight=309.425    }}
 +
{{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}}
 +
{{#set: produced by=RXN-8497}}

Revision as of 13:15, 21 March 2018

Metabolite CPD-8678

  • smiles:
    • CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
  • inchi key:
    • InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
  • common name:
    • 9(S)-HPOTE
  • molecular weight:
    • 309.425
  • Synonym(s):
    • 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
    • 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2-AMINOACRYLATE&oldid=16992"