Difference between revisions of "PWY-4821"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7765 PWY-7765] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7765 PWY-7765] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxy-4-methyl-anthranilate biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-hydroxy-4-methyl-anthranilic acid biosynthesis II |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] | |
| − | * [[RXN- | + | ** 3 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-26_002430]] |
| + | *** [[Ec-26_001830]] | ||
| + | *** [[Ec-28_001680]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-8665]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-20_001720]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ARYLFORMAMIDASE-RXN ARYLFORMAMIDASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17499 RXN-17499] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17500 RXN-17500] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=3-hydroxy-4-methyl-anthranilate biosynthesis II}} | |
| − | + | {{#set: common name=3-hydroxy-4-methyl-anthranilic acid biosynthesis II}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=40.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 13:15, 21 March 2018
Pathway PWY-7765
- taxonomic range:
- common name:
- 3-hydroxy-4-methyl-anthranilate biosynthesis II
- Synonym(s):
- 3-hydroxy-4-methyl-anthranilic acid biosynthesis II
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- KYNURENINE-3-MONOOXYGENASE-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8665
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
