Difference between revisions of "HYDROXYPRODEG-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * smiles: ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9725 RXN-9725] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J
+
** [http://enzyme.expasy.org/EC/1.3.1.77 EC-1.3.1.77]
−
* common name:
+
−
** (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA
+
−
* molecular weight:
+
−
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-14:1-Δ7-CoA
 
−
** (S)-3-hydroxy-7-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17794]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 3 [[PROTON]][c] '''+''' 1 [[CPD-591]][c] '''+''' 2 [[NADPH]][c] '''=>''' 2 [[NADP]][c] '''+''' 1 [[CPD-7630]][c]
−
* [[RXN-17793]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 3 H+[c] '''+''' 1 cyanidin[c] '''+''' 2 NADPH[c] '''=>''' 2 NADP+[c] '''+''' 1 (-)-epicatechin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-23_001220]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-12_005240]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-12_001350]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-6035]], 2,3-cis-flavanols biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06542 R06542]
−
{{#set: common name=(S)-3-hydroxy-(7Z)-tetradecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=987.845    }}
+
{{#set: ec number=EC-1.3.1.77}}
−
{{#set: common name=(S)-3-hydroxy-14:1-Δ7-CoA|(S)-3-hydroxy-7-cis-tetradecenoyl-CoA}}
+
{{#set: gene associated=Ec-23_001220|Ec-12_005240|Ec-12_001350}}
−
{{#set: consumed by=RXN-17794}}
+
{{#set: in pathway=PWY-6035}}
−
{{#set: produced by=RXN-17793}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 13:16, 21 March 2018

Reaction RXN-9725

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 3 H+[c] + 1 cyanidin[c] + 2 NADPH[c] => 2 NADP+[c] + 1 (-)-epicatechin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6035, 2,3-cis-flavanols biosynthesis: PWY-6035
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=HYDROXYPRODEG-PWY&oldid=17206"