Difference between revisions of "PWY-101"

Revision as of 13:17, 21 March 2018

common name:
- an S-sulfanyl-[L-cysteine desulfurase]
Synonym(s):
- a persulfurated L-cysteine desulfurase
- an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine

"an S-sulfanyl-[L-cysteine desulfurase" cannot be used as a page name in this wiki.

"an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Persulfurated-L-cysteine-desulfurases Persulfurated-L-cysteine-desulfurases] ==
-* smiles:
-** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
-* inchi key:
-** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
 * common name:
-** quinoxaline-2-carboxyl adenylate
+** an S-sulfanyl-[L-cysteine desulfurase]
-* molecular weight:
-** 502.359
 * Synonym(s):
+** a persulfurated L-cysteine desulfurase
+** an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine
 == Reaction(s) known to consume the compound ==
-* [[RXN-17155]]
+* [[RXN-14381]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-15881]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
+{{#set: common name=an S-sulfanyl-[L-cysteine desulfurase]}}
-{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
+{{#set: common name=a persulfurated L-cysteine desulfurase|an [L-cysteine desulfurase]-S-sulfanyl-L-cysteine}}
-{{#set: common name=quinoxaline-2-carboxyl adenylate}}
+{{#set: consumed by=RXN-14381}}
-{{#set: molecular weight=502.359    }}
+{{#set: produced by=RXN-15881}}
-{{#set: consumed by=RXN-17155}}