Difference between revisions of "UDP-SULFOQUINOVOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-07_002390 == * left end position: ** 2617179 * transcription direction: ** NEGATIVE * right end position: ** 2623620 * centisome position: ** 33.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_002390 == |
− | * | + | * left end position: |
− | ** | + | ** 2617179 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2623620 |
− | * | + | * centisome position: |
− | ** | + | ** 33.890614 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0061_0119 |
− | ** | + | ** Esi0061_0119 |
− | ** | + | ** RPE |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RIBULP3EPIM-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[P124-PWY]] | ||
+ | * [[CALVIN-PWY]] | ||
+ | * [[P21-PWY]] | ||
+ | * [[PWY-5723]] | ||
+ | * [[PWY-1861]] | ||
+ | * [[P122-PWY]] | ||
+ | * [[P185-PWY]] | ||
+ | * [[NONOXIPENT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2617179}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2623620}} | |
− | + | {{#set: centisome position=33.890614 }} | |
− | + | {{#set: common name=Esi_0061_0119|Esi0061_0119|RPE}} | |
− | + | {{#set: reaction associated=RIBULP3EPIM-RXN}} | |
− | + | {{#set: pathway associated=P124-PWY|CALVIN-PWY|P21-PWY|PWY-5723|PWY-1861|P122-PWY|P185-PWY|NONOXIPENT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:17, 21 March 2018
Gene Ec-07_002390
- left end position:
- 2617179
- transcription direction:
- NEGATIVE
- right end position:
- 2623620
- centisome position:
- 33.890614
- Synonym(s):
- Esi_0061_0119
- Esi0061_0119
- RPE
Reactions associated
- Reaction: RIBULP3EPIM-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome