Difference between revisions of "PHENYLACETATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...")
(Created page with "Category:Gene == Gene Ec-04_002810 == * left end position: ** 2908274 * transcription direction: ** POSITIVE * right end position: ** 2917791 * centisome position: ** 44.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] ==
+
== Gene Ec-04_002810 ==
−
* smiles:
+
* left end position:
−
** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)
+
** 2908274
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-equol
+
** 2917791
−
* molecular weight:
+
* centisome position:
−
** 242.274    
+
** 44.661247    
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-isoflavandiol
+
** Esi_0244_0045
 +
** Esi0244_0045
 +
** PSY
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.5.1.32-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-15589]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-13323]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN1F-144]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXNARA-8002]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6287]]
 +
* [[PWY-5942]]
 +
* [[PWY-6475]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=2908274}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14131 C14131]
+
{{#set: transcription direction=POSITIVE}}
−
* Wikipedia : Equol
+
{{#set: right end position=2917791}}
−
* HMDB : HMDB02209
+
{{#set: centisome position=44.661247   }}
−
* CHEBI:
+
{{#set: common name=Esi_0244_0045|Esi0244_0045|PSY}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34741 34741]
+
{{#set: reaction associated=2.5.1.32-RXN|RXN-13323|RXN1F-144|RXNARA-8002}}
−
* PUBCHEM:
+
{{#set: pathway associated=PWY-6287|PWY-5942|PWY-6475}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91469 91469]
+
−
{{#set: smiles=C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)}}
+
−
{{#set: inchi key=InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N}}
+
−
{{#set: common name=(S)-equol}}
+
−
{{#set: molecular weight=242.274   }}
+
−
{{#set: common name=4',7-isoflavandiol}}
+
−
{{#set: reversible reaction associated=RXN-15589}}
+

Revision as of 13:17, 21 March 2018

Gene Ec-04_002810

  • left end position:
    • 2908274
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2917791
  • centisome position:
    • 44.661247
  • Synonym(s):
    • Esi_0244_0045
    • Esi0244_0045
    • PSY

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PHENYLACETATE&oldid=17306"