Difference between revisions of "CPD-14115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] == * smiles: ** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6)))))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M |
* common name: | * common name: | ||
− | ** | + | ** pheophorbide a |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 590.677 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** pheide a |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17252]] | ||
+ | * [[RXN-7740]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658422 90658422] |
− | * | + | * CHEMSPIDER: |
− | {{#set: smiles= | + | ** [http://www.chemspider.com/Chemical-Structure.4481064.html 4481064] |
− | {{#set: inchi key=InChIKey= | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58687 58687] |
− | {{#set: molecular weight= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C18021 C18021] |
− | {{#set: | + | {{#set: smiles=C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))}} |
− | + | {{#set: inchi key=InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M}} | |
+ | {{#set: common name=pheophorbide a}} | ||
+ | {{#set: molecular weight=590.677 }} | ||
+ | {{#set: common name=pheide a}} | ||
+ | {{#set: consumed by=RXN-17252|RXN-7740}} |
Revision as of 13:17, 21 March 2018
Contents
Metabolite CPD-7061
- smiles:
- C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))
- inchi key:
- InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M
- common name:
- pheophorbide a
- molecular weight:
- 590.677
- Synonym(s):
- pheide a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))" cannot be used as a page name in this wiki.