Difference between revisions of "CYSTATHIONINE-BETA-SYNTHASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8625 CPD-8625] == * common name: ** a [protein]-L-proline (ω = 0) * Synonym(s): ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == * smiles: ** C(O)(C([O-])=O)NC(N)=O * inchi key: ** InChIKey=NWZYYCVIOKVT...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == |
| + | * smiles: | ||
| + | ** C(O)(C([O-])=O)NC(N)=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** S-ureidoglycolate |
| + | * molecular weight: | ||
| + | ** 133.083 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (-)-ureidoglycolate |
| + | ** ureidoglycolate | ||
| + | ** S-(-)-ureidoglycolate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ALLANTOICASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 2017665 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615273 23615273] |
| + | * HMDB : HMDB01005 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00603 C00603] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19951218.html 19951218] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57296 57296] | ||
| + | * BIGG : 1483307 | ||
| + | {{#set: smiles=C(O)(C([O-])=O)NC(N)=O}} | ||
| + | {{#set: inchi key=InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M}} | ||
| + | {{#set: common name=S-ureidoglycolate}} | ||
| + | {{#set: molecular weight=133.083 }} | ||
| + | {{#set: common name=(-)-ureidoglycolate|ureidoglycolate|S-(-)-ureidoglycolate}} | ||
| + | {{#set: produced by=ALLANTOICASE-RXN}} | ||
Revision as of 13:17, 21 March 2018
Contents
Metabolite CPD-1091
- smiles:
- C(O)(C([O-])=O)NC(N)=O
- inchi key:
- InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
- common name:
- S-ureidoglycolate
- molecular weight:
- 133.083
- Synonym(s):
- (-)-ureidoglycolate
- ureidoglycolate
- S-(-)-ureidoglycolate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2017665
- PUBCHEM:
- HMDB : HMDB01005
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 1483307
"C(O)(C([O-])=O)NC(N)=O" cannot be used as a page name in this wiki.
