Difference between revisions of "PWY-7307"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TOLUENE-DEG-CATECHOL-PWY TOLUENE-DEG-CATECHOL-PWY] == * taxonomic range: ** [http://metacyc.org/META/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TOLUENE-DEG-CATECHOL-PWY TOLUENE-DEG-CATECHOL-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** toluene degradation to benzoate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** toluene degradation via catechol |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] |
− | == Reaction(s) | + | ** 0 associated gene: |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=BENZYL-ALC-DEHYDROGENASE-RXN BENZYL-ALC-DEHYDROGENASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TOLUENE-SIDE-CHAIN-MONOOXYGENASE-RXN TOLUENE-SIDE-CHAIN-MONOOXYGENASE-RXN] | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-PWY : tol |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=toluene degradation to benzoate}} | |
− | + | {{#set: common name=toluene degradation via catechol}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:17, 21 March 2018
Contents
Pathway TOLUENE-DEG-CATECHOL-PWY
- taxonomic range:
- common name:
- toluene degradation to benzoate
- Synonym(s):
- toluene degradation via catechol
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : tol