Difference between revisions of "CPD-7649"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-241 PWY-241] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-241 PWY-241] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** C4 photosynthetic carbon assimilation cycle, NADP-ME type |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** PCA cycle | ||
| + | ** C4 photosynthesis, NADP-ME type | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''4''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[MALIC-NADP-RXN]] | |
| − | * [[RXN- | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-01_003680]] |
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[PEPCARBOX-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-28_003470]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-18_001310]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[RXN0-5224]] | ||
| + | ** 8 associated gene(s): | ||
| + | *** [[Ec-03_001960]] | ||
| + | *** [[Ec-10_002770]] | ||
| + | *** [[Ec-06_004120]] | ||
| + | *** [[Ec-05_001290]] | ||
| + | *** [[Ec-27_005680]] | ||
| + | *** [[Ec-07_004610]] | ||
| + | *** [[Ec-22_001150]] | ||
| + | *** [[Ec-16_004700]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=MALATE-DEHYDROGENASE-NADP+-RXN MALATE-DEHYDROGENASE-NADP+-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3193}} | |
| − | + | {{#set: common name=C4 photosynthetic carbon assimilation cycle, NADP-ME type}} | |
| − | {{#set: | + | {{#set: common name=PCA cycle|C4 photosynthesis, NADP-ME type}} |
| − | {{#set: | + | {{#set: reaction found=4}} |
| − | {{#set: common name= | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=80.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:18, 21 March 2018
Pathway PWY-241
- taxonomic range:
- common name:
- C4 photosynthetic carbon assimilation cycle, NADP-ME type
- Synonym(s):
- PCA cycle
- C4 photosynthesis, NADP-ME type
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- MALIC-NADP-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PEPCARBOX-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN0-5224
- 8 associated gene(s):
- 1 reconstruction source(s) associated:
