Difference between revisions of "CPD-17368"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_000770 == * Synonym(s): ** Esi_0027_0032 ** Esi0027_0032 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHEME SIROHEME] == * smiles: ** CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHEME SIROHEME] == |
| + | * smiles: | ||
| + | ** CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O)[O-])=C7(N([Fe--]25([N+]1(C(C(CCC([O-])=O)=C(CC(=O)[O-])C=1C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(N23)=CC4=[N+]56))=C7)))8)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=DLKSSIHHLYNIKN-QIISWYHFSA-D | ||
| + | * common name: | ||
| + | ** siroheme | ||
| + | * molecular weight: | ||
| + | ** 908.611 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[SIROHEME-FERROCHELAT-RXN]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678579 70678579] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60052 60052] | ||
| + | * BIGG : 35869 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00748 C00748] | ||
| + | {{#set: smiles=CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O)[O-])=C7(N([Fe--]25([N+]1(C(C(CCC([O-])=O)=C(CC(=O)[O-])C=1C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(N23)=CC4=[N+]56))=C7)))8))))}} | ||
| + | {{#set: inchi key=InChIKey=DLKSSIHHLYNIKN-QIISWYHFSA-D}} | ||
| + | {{#set: common name=siroheme}} | ||
| + | {{#set: molecular weight=908.611 }} | ||
| + | {{#set: produced by=SIROHEME-FERROCHELAT-RXN}} | ||
Revision as of 13:18, 21 March 2018
Contents
Metabolite SIROHEME
- smiles:
- CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O)[O-])=C7(N([Fe--]25([N+]1(C(C(CCC([O-])=O)=C(CC(=O)[O-])C=1C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(N23)=CC4=[N+]56))=C7)))8))))
- inchi key:
- InChIKey=DLKSSIHHLYNIKN-QIISWYHFSA-D
- common name:
- siroheme
- molecular weight:
- 908.611
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC4(CC(=O)[O-])(C(CCC(=O)[O-])C6(=CC8(=C(CC([O-])=O)C(CCC(=O)[O-])=C7(N([Fe--]25([N+]1(C(C(CCC([O-])=O)=C(CC(=O)[O-])C=1C=C3(C(C)(CC(=O)[O-])C(CCC(=O)[O-])C(N23)=CC4=[N+]56))=C7)))8))))" cannot be used as a page name in this wiki.
