Difference between revisions of "3-SULFINOALANINE-AMINOTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-16_003300 == * left end position: ** 3445679 * transcription direction: ** POSITIVE * right end position: ** 3453148 * centisome position: ** 64.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_003300 == |
− | * | + | * left end position: |
− | ** | + | ** 3445679 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3453148 |
− | * | + | * centisome position: |
− | ** | + | ** 64.554184 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0030_0135 |
− | ** | + | ** Esi0030_0135 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-6359]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[THIOSULFATE-SULFURTRANSFERASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5350]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3445679}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3453148}} | |
− | + | {{#set: centisome position=64.554184 }} | |
− | + | {{#set: common name=Esi_0030_0135|Esi0030_0135}} | |
− | + | {{#set: reaction associated=RXN0-6359|THIOSULFATE-SULFURTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5350}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 14:18, 21 March 2018
Gene Ec-16_003300
- left end position:
- 3445679
- transcription direction:
- POSITIVE
- right end position:
- 3453148
- centisome position:
- 64.554184
- Synonym(s):
- Esi_0030_0135
- Esi0030_0135
Reactions associated
- Reaction: RXN0-6359
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: THIOSULFATE-SULFURTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome